| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | L-Lactic acid, sodium salt (1-13C) Basic information |
| Product Name: | L-Lactic acid, sodium salt (1-13C) | | Synonyms: | SODIUM L-LACTATE (1-13C);L-LACTIC ACID-1-13C, SODIUM SALT (AS AQU;L-Lactic acid-1-13C, sodium salt solution;Sodium L-lactate-1-13C solution;Sodium L-Lactate-!3C;Sodium L-lactate-1-13C solution;Sodium L-lactate (1-13C, 99%) 20% w/w in water;Sodium L-lactate (1-13C, 99%) 20% w/w in water, microbiological/pyrogen tested | | CAS: | 81273-81-6 | | MF: | C3H5NaO3 | | MW: | 113.07 | | EINECS: | | | Product Categories: | | | Mol File: | 81273-81-6.mol |  |
| | L-Lactic acid, sodium salt (1-13C) Chemical Properties |
| Melting point | 163-165 °C(lit.) | | form | Liquid | | color | Colorless to light yellow | | Optical Rotation | [α]25/D 12°, c = 1 in H2O | | InChI | 1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/t2-;/m0./s1/i3+1; | | InChIKey | NGSFWBMYFKHRBD-FWGDTYFGSA-M | | SMILES | [Na+].C[C@H](O)[13C]([O-])=O | | CAS Number Unlabeled | 867-56-1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | L-Lactic acid, sodium salt (1-13C) Usage And Synthesis |
| | L-Lactic acid, sodium salt (1-13C) Preparation Products And Raw materials |
|