| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | L-Tyrosine-ring-13C6 Basic information |
| Product Name: | L-Tyrosine-ring-13C6 | | Synonyms: | L-TYROSINE-RING-13C6, 99 ATOM % 13C;l-4-hydroxyphenyl-13c6-alanine;l-tyrosine-13c6(phenyl-13c6);L-Tyrosine-(phenyl-13C6)
;3,3-D2, 30%);[13C6]-L-Tyrosine;L-Tyrosine-(phenyl-13C?);L-Tyrosine-(phenyl-13C6) | | CAS: | 201595-63-3 | | MF: | C9H11NO3 | | MW: | 187.14 | | EINECS: | | | Product Categories: | Amino Acids 13C, 2H, 15N | | Mol File: | 201595-63-3.mol |  |
| | L-Tyrosine-ring-13C6 Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | density | 1.334±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | solubility | Aqueous Acid (Sparingly), Aqueous Base (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D -12.0°, c = 1 in 1 M HCl | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1+1,2+1,3+1,4+1,6+1,7+1 | | InChIKey | OUYCCCASQSFEME-HXCZJXEJSA-N | | SMILES | [H][C@](N)(C[13c]1[13cH][13cH][13c](O)[13cH][13cH]1)C(O)=O | | CAS Number Unlabeled | 60-18-4 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Tyrosine-ring-13C6 Usage And Synthesis |
| Uses | Labelled analogue of L-Tyrosine, one of the 22 proteinogenic amino acids that are used by cells to synthesize proteins. L-Tyrosine is biologically converted from L-phenylalanine and is in turn is converted to L-DOPA and further converted into the neurotransmitters: dopamine, norepinephrine, and epinephrine. |
| | L-Tyrosine-ring-13C6 Preparation Products And Raw materials |
|