2,2'-Dithiobis(5-nitropyridine) manufacturers
|
| | 2,2'-Dithiobis(5-nitropyridine) Basic information |
| Product Name: | 2,2'-Dithiobis(5-nitropyridine) | | Synonyms: | BIS(5-NITRO-2-PYRIDYL) DISULFIDE;2,2’-dithiobis(5-nitro-pyridin;Bis(5-nitro-2-pyridyl) disulfide, DTNP;5-nitro-2-(5-nitropyridin-2-yl)disulfanylpyridine;5-nitro-2-(5-nitropyridin-2-yl)disulfanyl-pyridine;5-nitro-2-[(5-nitro-2-pyridyl)disulfanyl]pyridine;2,2′-Dithiobis(5-nitropyridine),Bis(5-nitro-2-pyridyl) disulfide, DTNP;2,2'-Bis(5-nitropyridyl) disulfide | | CAS: | 2127-10-8 | | MF: | C10H6N4O4S2 | | MW: | 310.31 | | EINECS: | 218-344-7 | | Product Categories: | blocks;Pyridines | | Mol File: | 2127-10-8.mol |  |
| | 2,2'-Dithiobis(5-nitropyridine) Chemical Properties |
| Melting point | 155-157 °C(lit.) | | Boiling point | 139°C (rough estimate) | | density | 1.6508 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Store at RT. | | pka | -2.88±0.29(Predicted) | | form | solid | | color | Brown | | BRN | 305413 | | InChI | InChI=1S/C10H6N4O4S2/c15-13(16)7-1-3-9(11-5-7)19-20-10-4-2-8(6-12-10)14(17)18/h1-6H | | InChIKey | ROUFCTKIILEETD-UHFFFAOYSA-N | | SMILES | S(C1=NC=C([N+]([O-])=O)C=C1)SC1=NC=C([N+]([O-])=O)C=C1 | | CAS DataBase Reference | 2127-10-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 36/37/39 | | WGK Germany | 3 | | RTECS | UT2964000 | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,2'-Dithiobis(5-nitropyridine) Usage And Synthesis |
| Uses | 2,2′-Dithiobis(5-nitropyridine) was employed:
- as cysteine-activating reagent to study the NMR of G protein-coupled receptors
- in the deprotection assays for protected selenocysteine-containing peptides
- for deprotecting p-methoxybenzyl groups and acetamidomethyl groups from the side-chains of cysteine and selenocysteine
- to remove the p-methoxybenzyl protecting group from cysteine and selenocysteine side-chains
| | General Description | 2,2′-Dithiobis(5-nitropyridine) is an aromatic disulphide. |
| | 2,2'-Dithiobis(5-nitropyridine) Preparation Products And Raw materials |
|