| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- BOC-D-PYR-OH
-
- $1.00
-
2019-07-06
- CAS:160347-90-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1ton
|
| | Boc-D-Pyr-OH Basic information |
| Product Name: | Boc-D-Pyr-OH | | Synonyms: | (D)-Boc-5-oxopyrrolidine-2-carboxylicacid;N-Boc-5-oxo-D-proline, 97%;N-alpha-t-Butyloxycarbonyl-D-pyroglutamic acid;(2R)-5-Oxo-1,2-pyrrolidinedicarboxylic acid 1-(tert-bytyl) ester;Boc-D-pGlu-OH;N-Boc-D-pyroglutamic acid;Boc-D-pyroglutamic acid≥ 98% (HPLC);(2R)-1-[(tert-butoxy)carbonyl]-5-oxopyrrolidine-2-carboxylic acid | | CAS: | 160347-90-0 | | MF: | C10H15NO5 | | MW: | 229.23 | | EINECS: | | | Product Categories: | | | Mol File: | 160347-90-0.mol |  |
| | Boc-D-Pyr-OH Chemical Properties |
| Melting point | 111-116℃ | | Boiling point | 425.8±38.0 °C(Predicted) | | density | 1.304 | | storage temp. | 2-8°C | | pka | 3.04±0.20(Predicted) | | form | powder | | Appearance | White to off-white Solid | | Optical Rotation | [α]22/D +35°, c = 1 in chloroform | | Water Solubility | Slightly soluble in water. | | Sensitive | Moisture Sensitive | | Major Application | peptide synthesis | | InChI | 1S/C10H15NO5/c1-10(2,3)16-9(15)11-6(8(13)14)4-5-7(11)12/h6H,4-5H2,1-3H3,(H,13,14)/t6-/m1/s1 | | InChIKey | MJLQPFJGZTYCMH-ZCFIWIBFSA-N | | SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 |
| | Boc-D-Pyr-OH Usage And Synthesis |
| Chemical Properties | White powder | | Uses | Used as pharmaceutical intermediates and anesthetic agent. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-D-Pyr-OH Preparation Products And Raw materials |
|