|
|
| | 1,3-Propylenediaminetertaacetic acid Basic information |
| Product Name: | 1,3-Propylenediaminetertaacetic acid | | Synonyms: | TRIMETHYLENEDIAMINE-N,N,N',N'-TETRAACETIC ACID;1,3-DIAMINOPROPANE-N,N,N',N'-TETRAACETIC ACID;1,3-propylenediamine-n,n,n',n'-tetraacetic acid;1,3-Propylenediaminetertaacetic acid;2-[3-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]ethanoic acid;2,2',2'',2'''-(Propane-1,3-diylbis(azanetriyl))tetraacetic acid;1,3-Diaminopropane-N,N,N',N'-tetraacetic acid >=99.0% (KT);1,3-Propanediamine-N,N,N',N'-tetraacetic Acid | | CAS: | 1939-36-2 | | MF: | C11H18N2O8 | | MW: | 306.27 | | EINECS: | 400-400-9 | | Product Categories: | Organic acids | | Mol File: | 1939-36-2.mol |  |
| | 1,3-Propylenediaminetertaacetic acid Chemical Properties |
| Melting point | ~250 °C (dec.) | | Boiling point | 620.5±55.0 °C(Predicted) | | density | 1.507±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Water Solubility | Soluble in water | | form | powder to crystal | | pka | 1.45±0.10(Predicted) | | color | White to Almost white | | BRN | 1716449 | | InChI | InChI=1S/C11H18N2O8/c14-8(15)4-12(5-9(16)17)2-1-3-13(6-10(18)19)7-11(20)21/h1-7H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) | | InChIKey | DMQQXDPCRUGSQB-UHFFFAOYSA-N | | SMILES | C(N(CC(O)=O)CC(O)=O)CCN(CC(O)=O)CC(O)=O | | CAS DataBase Reference | 1939-36-2(CAS DataBase Reference) | | EPA Substance Registry System | Trimethylenediaminetetraacetic acid (1939-36-2) |
| Hazard Codes | Xn,N | | Risk Statements | 22-41-50/53-62-63 | | Safety Statements | 22-26-39-60-61-36/37 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 | | RTECS | MC1082500 | | TSCA | TSCA listed | | HS Code | 2922.49.8000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Dam. 1
Repr. 2 |
| | 1,3-Propylenediaminetertaacetic acid Usage And Synthesis |
| Uses | 1,3-Diaminopropane-N,N,N',N'-tetraacetic acid (1,3-DAPTA) is a kind of biochemical reagent. | | References | [1] Bergmeyer, et al. "Biochemical reagents." Methods of Enzymatic Analysis. Academic Press, 1965. 967-1037. |
| | 1,3-Propylenediaminetertaacetic acid Preparation Products And Raw materials |
|