| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Ark Pharm, Inc. |
| Tel: |
847-367-3680 |
| Email: |
sales@arkpharminc.com |
|
| | 2-Chloro-5-(trifluoromethyl)benzonitrile Basic information |
| | 2-Chloro-5-(trifluoromethyl)benzonitrile Chemical Properties |
| Melting point | 38-42 °C(lit.) | | Boiling point | 210-212 °C(lit.) | | density | 1.481 g/mL at 25 °C(lit.) | | Fp | 215 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Gray to Brown | | BRN | 1912184 | | InChI | InChI=1S/C8H3ClF3N/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-3H | | InChIKey | LCISFYAQKHOWBP-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(C(F)(F)F)=CC=C1Cl | | CAS DataBase Reference | 328-87-0(CAS DataBase Reference) | | EPA Substance Registry System | Benzonitrile, 2-chloro-5-(trifluoromethyl)- (328-87-0) |
| Hazard Codes | Xi,T,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-36/37/39-22 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Toxic | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Chloro-5-(trifluoromethyl)benzonitrile Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 4-Chloro-3-cyanobenzotrifluoride (CAS# 328-87-0) can be used to produce a thermal coupler control system in water supply systems. | | General Description | Synthesis of 2-chloro-5-trifluoromethyl-benzonitrile, via Sandmeyer reaction of 2-chloro-5-trifluoromethylaniline with copper cyanide/sodium cyanide, is reported. |
| | 2-Chloro-5-(trifluoromethyl)benzonitrile Preparation Products And Raw materials |
|