| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-(S)-3-amino-4-(4-pyridyl)-butyric acid Basic information |
| Product Name: | Boc-(S)-3-amino-4-(4-pyridyl)-butyric acid | | Synonyms: | (s)-boc-4-(4-pyridyl)-β-homoala-oh;Boc-b-HoAla(4-pyridyl)-OH;(S)-3-(Boc-amino)-4-(4-pyridyl)butyric acid, Boc-4-(4-pyridyl)-L-β-homoalanine;(S)-3-((tert-Butoxycarbonyl)amino)-4-(pyridin-4-yl)butanoic acid;N-T-BUTOXYCARBONYL-(S)-3-AMINO-4-(4-PYRIDYL)BUTANOIC ACID;N-BETA-T-BUTOXYCARBONYL-L-HOMO(4-PYRIDYL)ALANINE;RARECHEM AK PT B031;(S)-3-(BOC-AMINO)-4-(4-PYRIDYL)BUTYRIC ACID | | CAS: | 219297-13-9 | | MF: | C14H20N2O4 | | MW: | 280.32 | | EINECS: | | | Product Categories: | 3-Amino-4-phenylbutanoic Acid Analogs | | Mol File: | 219297-13-9.mol |  |
| | Boc-(S)-3-amino-4-(4-pyridyl)-butyric acid Chemical Properties |
| Melting point | 140-143℃ | | Boiling point | 471.225±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.176±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | pka | 4.268±0.10(predicted) | | form | powder | | Major Application | peptide synthesis | | InChI | 1S/C14H20N2O4/c1-14(2,3)20-13(19)16-11(9-12(17)18)8-10-4-6-15-7-5-10/h4-7,11H,8-9H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 | | InChIKey | BYTKQINZDKLYGV-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1ccncc1 | | CAS DataBase Reference | 219297-13-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Boc-(S)-3-amino-4-(4-pyridyl)-butyric acid Usage And Synthesis |
| Uses | (S)-3-(Boc-amino)-4-(4-pyridyl)butyric acid is used as pharmaceutical intermediate. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-(S)-3-amino-4-(4-pyridyl)-butyric acid Preparation Products And Raw materials |
|