|
|
| | ACETYLSALICYLIC ANHYDRIDE Basic information |
| | ACETYLSALICYLIC ANHYDRIDE Chemical Properties |
| Melting point | 80-83 °C | | Boiling point | 511.2±35.0 °C(Predicted) | | density | 1.306±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | BRN | 2015320 | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C18H14O7/c1-11(19)23-15-9-5-3-7-13(15)17(21)25-18(22)14-8-4-6-10-16(14)24-12(2)20/h3-10H,1-2H3 | | InChIKey | OAWXYINGQXLWOE-UHFFFAOYSA-N | | SMILES | C(=O)(OC(=O)C1C=CC=CC=1OC(C)=O)C1C=CC=CC=1OC(C)=O |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 3 | | RTECS | VO0710000 | | F | 10-21 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| | ACETYLSALICYLIC ANHYDRIDE Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | Acetylsalicylic Acid Impurity D | | Uses | Acetylsalicylic Acid (A187780) Impurity D. | | Synthesis | General procedure for the synthesis of 2-(acetyloxy)benzoic anhydride from acetylsalicylic acid:
1. prepare a suspension of 2-acetoxybenzoic acid (5.0 g, 28 mmol) in 30 mL of dichloromethane.
2. a solution of N,N'-dicyclohexylcarbodiimide (DCC, 2.9 g, 13.9 mmol) in 10 mL of dichloromethane was added to the above suspension.
3. The reaction mixture was stirred at room temperature overnight.
4. After completion of the reaction, the by-product dicyclohexylurea (DCU) was filtered through a glass filter and washed with a small amount of dichloromethane.
5. The solvent was evaporated and the resulting residue was dissolved in ethyl acetate.
6. The resulting suspension was filtered through a glass filter to remove residual DCU.
7. The filtrate was evaporated to give 2-(acetyloxy)benzoic anhydride as a clear thick oil, which solidified after storage at -20 °C.
Yield: 4.6 g (quantitative).
1H NMR (CDCl3, 400 MHz): δ 8.08 (d, 2H, J = 7.9 Hz), 7.70 (t, 2H, J = 7.8 Hz), 7.40 (t, 2H, J = 7.7 Hz), 7.19 (d, 2H, J = 8.1 Hz), 2.31 (s, 6H).
13C NMR (CDCl3, 100 MHz): δ 169.42, 159.29, 151.83, 135.54, 132.24, 126.29, 124.42, 121.69, 20.89.
IR (KBr) νmax (cm-1): 3570 (w), 3491 (w), 3445 (w), 3332 (br), 3205 (w), 3100 (s, CH), 2932 (s, CH), 2855 (w), 2409 (w), 2032 (w), 1789 (br, C=O), 1728 (br, C=O) , 1603 (s, C=C), 1581 (s), 1484 (s), 1451 (s), 1369 (s), 916 (s), 506 (s).
HRMS m/z Calcd. for C18H14Na7O6: (M + Na)+ 365.0637. Found: 365.0638.
Melting point: 80-85°C. | | References | [1] Patent: WO2015/89389, 2015, A1. Location in patent: Paragraph 0098 [2] Tetrahedron Letters, 2016, vol. 57, # 3, p. 325 - 328 [3] Synthetic Communications, 2001, vol. 31, # 3, p. 395 - 399 [4] Chemische Berichte, 1910, vol. 43, p. 2990 [5] Chem. Zentralbl., 1911, vol. 82, # I, p. 1568 |
| | ACETYLSALICYLIC ANHYDRIDE Preparation Products And Raw materials |
|