|
|
| | 4-NITROPHENYL-N-ACETYL-BETA-D-GLUCOSAMINIDE Basic information |
| | 4-NITROPHENYL-N-ACETYL-BETA-D-GLUCOSAMINIDE Chemical Properties |
| Melting point | 210-212 °C | | alpha | -14～-18°(D/20℃) (c=0,H2O) | | Boiling point | 477.77°C (rough estimate) | | density | 1.3038 (rough estimate) | | refractive index | 1.5110 (estimate) | | storage temp. | -20°C | | solubility | H2O: 5 mg/mL, clear, colorless to very faintly yellow | | pka | 12.76±0.70(Predicted) | | form | Fine Powder | | color | White to off-white | | Water Solubility | water: 5mg/mL, clear, colorless to very faintly yellow | | λmax | 400nm(Phosphate buffer sol.)(lit.) | | BRN | 96193 | | InChI | InChI=1/C14H18N2O8/c1-7(18)15-11-13(20)12(19)10(6-17)24-14(11)23-9-4-2-8(3-5-9)16(21)22/h2-5,10-14,17,19-20H,6H2,1H3,(H,15,18)/t10-,11-,12-,13-,14-/s3 | | InChIKey | OMRLTNCLYHKQCK-DOSMMQPLNA-N | | SMILES | O(C1C=CC(N(=O)=O)=CC=1)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NC(=O)C |&1:10,12,15,17,19,r| | | CAS DataBase Reference | 3459-18-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | 4-NITROPHENYL-N-ACETYL-BETA-D-GLUCOSAMINIDE Usage And Synthesis |
| Chemical Properties | Slightly Off-White Crystalline Solid | | Uses | 4-Nitrophenyl-N-acetyl-β- D-glucosaminide is a useful substrate for the rapid colorimetric assay of N-Acetyl-beta-glucosaminidase in human urine | | Uses | substrate for a-L-fucosidases | | Uses | Useful substrate for the rapid colorimetric assay of N-Acetyl-beta-glucosaminidase in human urine. | | Definition | ChEBI: An N-acetyl-beta-D-glucosaminide in which the anomeric hydroxy hydrogen is replaced by a 4-nitrophenyl group. | | Biological Activity | 4-Nitrophenyl N-acetyl-β-D-glucosaminide (NP-GlcNAc) is a widely used hexosaminidase substrate. Enzymatic action cleaves the glycosidic bond and forms 4-nitrophenolate (pNP) which is measured at 405 nm. NP-GlcNAc can also be used in combination with diethylaminoethyl-a-cyclodextrin (DEn-CD) for a rapid and accurate rate assay method for b-N-acetylglucosaminidase. The cyclodextrin derivative is used as an additive to ionize 4-nitrophenol to yellow-colored 4-nitrophenoxide at a pH near 5, the pH optimum for the enzyme. |
| | 4-NITROPHENYL-N-ACETYL-BETA-D-GLUCOSAMINIDE Preparation Products And Raw materials |
|