|
|
| | alpha,beta-Trehalose Basic information |
| Product Name: | alpha,beta-Trehalose | | Synonyms: | beta-D-Glucopyranosyl alpha-D-glucopyranoside;ALPHA-D-GLUCOPYRANOSYL BETA-D-GLUCOPYRANOSIDE;A,B-trehalose;ALL-TRANS-RETINOYL BETA-GLUCURONIDE;Neotrehalose, α-D-Glucopyranosyl β-D-glucopyranoside;α,β-trehalose;α,β-Trehalose, CAS 585-91-1;NEOTREHALOSE | | CAS: | 585-91-1 | | MF: | C12H22O11 | | MW: | 342.3 | | EINECS: | | | Product Categories: | | | Mol File: | 585-91-1.mol |  |
| | alpha,beta-Trehalose Chemical Properties |
| Melting point | 195-210℃ | | Boiling point | 675.4±55.0 °C(Predicted) | | density | 1.76±0.1 g/cm3(Predicted) | | pka | 12.53±0.70(Predicted) | | form | Solid | | color | White to off-white | | biological source | plant | | InChI | 1S/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12+/m1/s1 | | InChIKey | HDTRYLNUVZCQOY-BTLHAWITSA-N | | SMILES | OC[C@H]1O[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | alpha,beta-Trehalose Usage And Synthesis |
| Chemical Properties | White to off-white crystalline powder | | Uses | a,b-Trehalose can be useful in identification of maturity of acacia honey by endogenous oligosaccharide in preliminary study. | | Definition | ChEBI: Alpha,beta-trehalose is a trehalose in which one of the glucose residues has alpha-configuration at the anomeric carbon, while the other has alpha-configuration. It is a trehalose, an alpha-D-glucoside and a beta-D-glucoside. |
| | alpha,beta-Trehalose Preparation Products And Raw materials |
|