| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (+)-Chloromethyl isomenthyl ether Basic information |
| | (+)-Chloromethyl isomenthyl ether Chemical Properties |
| Boiling point | 206 °C(lit.) | | density | 0.988 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.468(lit.) | | Fp | 222 °F | | storage temp. | -20°C | | Optical Rotation | [α]24/D 177.0°, c = 1 in methylene chloride | | InChI | 1S/C11H21ClO/c1-8(2)10-5-4-9(3)6-11(10)13-7-12/h8-11H,4-7H2,1-3H3/t9-,10+,11-/m1/s1 | | InChIKey | XOPLTFUYFXWFGB-OUAUKWLOSA-N | | SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCl |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+)-Chloromethyl isomenthyl ether Usage And Synthesis |
| Chemical Properties | CLEAR COLORLESS LIQUID |
| | (+)-Chloromethyl isomenthyl ether Preparation Products And Raw materials |
|