| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Ethyl 4-nitrocinnamate manufacturers
|
| | Ethyl 4-nitrocinnamate Basic information |
| | Ethyl 4-nitrocinnamate Chemical Properties |
| Melting point | 138-140 °C(lit.) | | Boiling point | 362.26°C (rough estimate) | | density | 0.87 g/cm3 (20℃) | | refractive index | 1.5200 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Fine Crystalline Powder | | color | Light yellow-beige to yellow | | Water Solubility | insoluble | | BRN | 2052533 | | InChI | 1S/C11H11NO4/c1-2-16-11(13)8-5-9-3-6-10(7-4-9)12(14)15/h3-8H,2H2,1H3/b8-5+ | | InChIKey | PFBQVGXIMLXCQB-VMPITWQZSA-N | | SMILES | CCOC(=O)\C=C\c1ccc(cc1)[N+]([O-])=O | | CAS DataBase Reference | 953-26-4(CAS DataBase Reference) | | NIST Chemistry Reference | Ethyl p-nitro cinnamate(953-26-4) | | EPA Substance Registry System | 2-Propenoic acid, 3-(4-nitrophenyl)-, ethyl ester (953-26-4) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | GE0353332 | | TSCA | TSCA listed | | HS Code | 29163900 | | Storage Class | 11 - Combustible Solids |
| | Ethyl 4-nitrocinnamate Usage And Synthesis |
| Chemical Properties | light yellow-beige to yellow fine cryst. powde | | Uses | Ethyl 4-nitrocinnamate was used to study the kinetics of reduction of ethyl t-cinnamate and its substituted derivatives by samarium diiodide in the presence of hexamethylphosphoramide and t-butanol. |
| | Ethyl 4-nitrocinnamate Preparation Products And Raw materials |
|