| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-2-(3-Cyclopentylpropen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Basic information |
| Product Name: | trans-2-(3-Cyclopentylpropen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | Synonyms: | TRANS-3-(CYCLOPENTYL)PROPENYLBORONIC ACID PINACOL ESTER;trans-3-(Cyclopentyl)-1-propenylboronic acid pinacol ester;trans-3-Cyclopentylpropen-1-ylboronic acid, pinacol ester;2-(3-Cyclopentylprop-1-en-1-yl)-4,4,5,5-tetraMethyl-1,3,2-dioxaborolane;2-[(1E)-3-Cyclopentyl-1-propen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;trans-3-(Cyclopentyl)-1-propenylboronic acid pinacol ester 97%;1,3,2-Dioxaborolane, 2-[(1E)-3-cyclopentyl-1-propen-1-yl]-4,4,5,5-tetramethyl-;(E)-2-(3-Cyclopentylprop-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | | CAS: | 1073354-57-0 | | MF: | C14H25BO2 | | MW: | 236.16 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | trans-2-(3-Cyclopentylpropen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Chemical Properties |
| Boiling point | 90-93 °C/0.4 mmHg | | density | 0.927 g/mL at 25 °C | | refractive index | n20/D 1.456 | | Fp | >110℃ | | storage temp. | 2-8°C | | InChI | 1S/C14H25BO2/c1-13(2)14(3,4)17-15(16-13)11-7-10-12-8-5-6-9-12/h7,11-12H,5-6,8-10H2,1-4H3/b11-7+ | | InChIKey | GXNIAKZVBGUMHU-YRNVUSSQSA-N | | SMILES | CC1(C)OB(OC1(C)C)\C=C\CC2CCCC2 |
| WGK Germany | 3 | | HS Code | 2931900090 | | Storage Class | 12 - Non Combustible Liquids |
| | trans-2-(3-Cyclopentylpropen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Usage And Synthesis |
| | trans-2-(3-Cyclopentylpropen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Preparation Products And Raw materials |
|