| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-1-Hepten-1-ylboronic acid pinacol ester Basic information |
| Product Name: | trans-1-Hepten-1-ylboronic acid pinacol ester | | Synonyms: | TRANS-1-HEPTENYLBORONIC ACID PINACOL ESTER;TRANS-1-HEPTENYL-1-BORONIC ACID PINACOL ESTER;TRANS-4,4,5,5-TETRAMETHYL-2-HEPT-1-ENYL-1,3,2-DIOXABOROLANE;E-2-(1-HEPTENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE;1-HEPTENYL-1-BORONIC ACID, PINACOL ESTER;trans-1-Heptenylboronic acid pinacol ester, E-2-(1-Heptenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;trans-1-Hepten-1-ylboronic acid pinacol ester, 97%;trans-1-Hepten-1-ylboronic acid pinacol ester 97% | | CAS: | 169339-75-7 | | MF: | C13H25BO2 | | MW: | 224.15 | | EINECS: | | | Product Categories: | Alkenyl Boronate Esters;Boronate Esters;Boronic Acids and Derivatives;Chemical Synthesis;Organometallic Reagents;Heterocyclic Compounds | | Mol File: | 169339-75-7.mol |  |
| | trans-1-Hepten-1-ylboronic acid pinacol ester Chemical Properties |
| Boiling point | 73-77 °C/0.4-0.5 mmHg | | density | 0.875 g/mL at 25 °C | | refractive index | 1.445 | | Fp | 73-77°C/0.5mm | | storage temp. | 2-8°C | | InChI | 1S/C13H25BO2/c1-6-7-8-9-10-11-14-15-12(2,3)13(4,5)16-14/h10-11H,6-9H2,1-5H3/b11-10+ | | InChIKey | XHEDFAYNMNXKGM-ZHACJKMWSA-N | | SMILES | CCCCC\C=C\B1OC(C)(C)C(C)(C)O1 |
| WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | trans-1-Hepten-1-ylboronic acid pinacol ester Usage And Synthesis |
| Uses | trans-1-Hepten-1-ylboronic acid pinacol ester can be used in a palladium-catalyzed cross-coupling with olefins providing substituted 1,3-dienes. | | Uses | Substrate used in a palladium-catalyzed cross-coupling with olefins providing substituted 1,3-dienes. |
| | trans-1-Hepten-1-ylboronic acid pinacol ester Preparation Products And Raw materials |
|