|
|
| | TRANS-2-BUTENE-1,4-DICARBOXYLIC ACID Basic information |
| | TRANS-2-BUTENE-1,4-DICARBOXYLIC ACID Chemical Properties |
| Melting point | 195-196 °C(lit.) | | Boiling point | 368.7±22.0 °C(Predicted) | | density | 1.305±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.96±0.10(Predicted) | | color | White to Off-White | | BRN | 1723581 | | InChI | 1S/C6H8O4/c7-5(8)3-1-2-4-6(9)10/h1-2H,3-4H2,(H,7,8)(H,9,10)/b2-1+ | | InChIKey | YHGNXQAFNHCBTK-OWOJBTEDSA-N | | SMILES | [H]\C(CC(O)=O)=C(\[H])CC(O)=O | | CAS DataBase Reference | 4436-74-2(CAS DataBase Reference) | | EPA Substance Registry System | 3-Hexenedioic acid (4436-74-2) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2917198090 | | Storage Class | 11 - Combustible Solids |
| | TRANS-2-BUTENE-1,4-DICARBOXYLIC ACID Usage And Synthesis |
| Uses | trans-3-Hexenedioic Acid is used as a starting material in the synthesis of Adipic Acid (A291590) which is primarily used in the synthesis of nylon. | | Definition | ChEBI: 3-hexenedioic acid is a hexenedioic acid where the C=C double bond is located at the 3-position. |
| | TRANS-2-BUTENE-1,4-DICARBOXYLIC ACID Preparation Products And Raw materials |
|