8-Hydroxyquinoline-2-sulfonic acid monohydrate manufacturers
|
| | 8-Hydroxyquinoline-2-sulfonic acid monohydrate Basic information |
| | 8-Hydroxyquinoline-2-sulfonic acid monohydrate Chemical Properties |
| Melting point | >300 °C(lit.) | | density | 1.632±0.06 g/cm3(Predicted) | | pka | -1.86±0.40(Predicted) | | InChI | InChI=1S/C9H7NO4S/c11-7-3-1-2-6-4-5-8(10-9(6)7)15(12,13)14/h1-5,11H,(H,12,13,14) | | InChIKey | QLJOSEUOQHDGTQ-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2O)C=CC=1S(O)(=O)=O |
| | 8-Hydroxyquinoline-2-sulfonic acid monohydrate Usage And Synthesis |
| Uses | 8-Hydroxy-quinoline-2-sulfonic Acid has therapeutic applications as a potential bromodomain-containing protein 4 inhibitor. | | Safety | Avoid contact with skin and eyes. Avoid formation of dust and aerosols.
Use non-sparking tools. Prevent fire caused by electrostatic discharge
steam. | | storage | Store the container tightly closed in a dry, cool and well-ventilated
place. Store apart from foodstuff containers or incompatible materials. |
| | 8-Hydroxyquinoline-2-sulfonic acid monohydrate Preparation Products And Raw materials |
|