| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Chlorocarbonylsulfenyl chloride Basic information |
| | Chlorocarbonylsulfenyl chloride Chemical Properties |
| Boiling point | 98 °C (lit.) | | density | 1.552 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.517(lit.) | | Fp | 98-101°C | | storage temp. | 2-8°C | | solubility | Acetonitrile (Slightly), Chloroform (Sparingly) | | form | Liquid, Fuming In Moist Air | | color | Yellow | | Sensitive | Moisture Sensitive | | BRN | 506318 | | Stability: | Moisture Sensitive | | InChI | InChI=1S/CCl2OS/c2-1(4)5-3 | | InChIKey | MNOALXGAYUJNKX-UHFFFAOYSA-N | | SMILES | C(=O)(Cl)SCl | | CAS DataBase Reference | 2757-23-5(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34-37 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 9-13-21 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29309090 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | Chlorocarbonylsulfenyl chloride Usage And Synthesis |
| Chemical Properties | Yellow liquid, fuming in moist air | | Uses | Chlorocarbonylsulfenyl chloride has been used in the preparation of:
- 5-(1,2,3,4-tetra-O-acetyl-alpha-D-xylopyranos-5S-C-yl)-1,3,4-oxathiazol-2-one
- fluorinated oxathialones
- polyfluoroalkylchlorothioformates
- chlorocarbonylpolyfluoroalkylsulfenate esters
- chlorocarbonylhexafluoroisopropylidenimino sulfenate
- 5-tri-fluoromethyl-2-oxo-1,3,4-oxathiazole
- commercially important N,N-dialkylcarbamoyl chlorides
|
| | Chlorocarbonylsulfenyl chloride Preparation Products And Raw materials |
|