|
|
| | 4-Morpholinecarbonyl chloride Basic information |
| | 4-Morpholinecarbonyl chloride Chemical Properties |
| Boiling point | 137-138 °C/33 mmHg (lit.) | | density | 1.282 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.498(lit.) | | Fp | >230 °F | | storage temp. | Inert atmosphere,2-8°C | | pka | -2.16±0.20(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | BRN | 116257 | | InChI | InChI=1S/C5H8ClNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2 | | InChIKey | XMWFMEYDRNJSOO-UHFFFAOYSA-N | | SMILES | C(Cl)(N1CCOCC1)=O | | CAS DataBase Reference | 15159-40-7(CAS DataBase Reference) | | EPA Substance Registry System | 4-Morpholinecarbonyl chloride (15159-40-7) |
| Hazard Codes | Xn | | Risk Statements | 14-36/38-40 | | Safety Statements | 26-30-36-38 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29349990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 |
| | 4-Morpholinecarbonyl chloride Usage And Synthesis |
| Uses | Photographic intermediate | | Uses | 4-Morpholinecarbonyl chloride may be used in the preparation of a versatile fluorogenic label for biomolecular imaging. It may be used in the synthesis of:
- morpholine-4-carboxylic acid [4-(2,4-dimethylphenyl)thiazol-2-yl]amide
- morpholine-4-carboxylic acid [4-(2,4,6-trimethylphenyl)thiazol-2-yl]amide
- 2-isopropyl-6-methylpyrimidin-4-yl morpholine-4-carboxylate
| | General Description | 4-Morpholinecarbonyl chloride is a photographic intermediate. Rates of solvolysis of 4-morpholinecarbonyl chloride with N-alkyl group in aqueous binary solvents of acetone, ethanol, methanol, methanol-d, 2,2,2-trifluoroethanol, pure water and D2O has been determined. Preparation of 4-morpholinecarbonyl chloride has been reported. | | Synthesis | 4-Morpholinecarbonyl chloride is prepared by reacting morpholine hydrochloride with phosgene in an inert liquid medium such as toluene and xylene, at 50W150°C, pref. 60W120°C. The morpholine hydrochloride is prepared by dissolving 1 part by weight of morpholine in ≥4 parts of an inert liquid medium and introducing a slightly excessive HCl into the solution under agitation.
|
| | 4-Morpholinecarbonyl chloride Preparation Products And Raw materials |
|