| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | 4-(Acetylamino)-benzoic acid ethyl ester Basic information |
| Product Name: | 4-(Acetylamino)-benzoic acid ethyl ester | | Synonyms: | RARECHEM AL BI 0078;p-(Acetylamino)benzoic acid ethyl ester;4-acetamidobenzoic acid ethyl ester;Benzoic acid, 4-(acetylamino)-, ethyl ester;N-Acetylbenzocaine;ETHYL 4-ACETAMIDOBENZOATE;4-(Acetylamino)-benzoic acid ethyl ester | | CAS: | 5338-44-3 | | MF: | C11H13NO3 | | MW: | 207.23 | | EINECS: | | | Product Categories: | | | Mol File: | 5338-44-3.mol |  |
| | 4-(Acetylamino)-benzoic acid ethyl ester Chemical Properties |
| Melting point | 181 °C | | Boiling point | 390.8±25.0 °C(Predicted) | | density | 1.171±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly) | | form | Solid | | pka | 14.59±0.70(Predicted) | | color | White | | Major Application | pharmaceutical small molecule | | InChI | 1S/C11H13NO3/c1-3-15-11(14)9-4-6-10(7-5-9)12-8(2)13/h4-7H,3H2,1-2H3,(H,12,13) | | InChIKey | NHLOBHNRBWKNIO-UHFFFAOYSA-N | | SMILES | N(c1ccc(cc1)C(=O)OCC)C(=O)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 4-(Acetylamino)-benzoic acid ethyl ester Usage And Synthesis |
| Uses | Ethyl 4-acetamidobenzoate is a reagent that is used in the synthesis of DAMPA-d3, which is a labeleld antitumor agent. |
| | 4-(Acetylamino)-benzoic acid ethyl ester Preparation Products And Raw materials |
|