| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | BOC-D-LYS(ALOC)-OH DCHA Basic information |
| Product Name: | BOC-D-LYS(ALOC)-OH DCHA | | Synonyms: | Dicyclohexylamine (R)-6-(((allyloxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)hexanoate;Nα-Boc-Nδ-Alloc-D-lysine (dicyclohexylammonium) salt, Nδ-Alloc-Nα-Boc-D-lysine (dicyclohexylammonium) salt;dicyclohexylamine (R)-2,2-dimethyl-4,12-dioxo-3,13-dioxa-5,11-diazahexadec-15-ene-6-carboxylate;N-alpha-Boc-N-epsilon-allyloxycarbonyl-D-lysine dicyclohexylamine;N-α-Boc-N-ε-allyloxycarbonyl-D-lysine dicyclohex;Boc-D-Lys(Alloc)-OH·DCHA N-α-Boc-N-ε-allyloxycarbonyl-D-lysinedicyclohexylaMinesalt;Nα-Boc-Nε-allyloxycarbonyl-D-lysine dicyclohexyl ammonium salt≥ 99% (HPLC);N-Boc-N-allyloxycarbonyl-D-lysine dicyclohexyl Ammonium Salt | | CAS: | 327156-94-5 | | MF: | C15H26N2O6.C12H23N | | MW: | 511.7 | | EINECS: | | | Product Categories: | | | Mol File: | 327156-94-5.mol |  |
| | BOC-D-LYS(ALOC)-OH DCHA Chemical Properties |
| storage temp. | 2-8°C(protect from light) | | form | powder | | Major Application | peptide synthesis | | InChIKey | TXVAVNGGMCSJEA-RFVHGSKJSA-N | | SMILES | C1CCC(CC1)NC2CCCCC2.CC(C)(C)OC(=O)N[C@H](CCCCNC(=O)OCC=C)C(O)=O |
| WGK Germany | 3 | | F | 10-23 | | Storage Class | 11 - Combustible Solids |
| | BOC-D-LYS(ALOC)-OH DCHA Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-D-LYS(ALOC)-OH DCHA Preparation Products And Raw materials |
|