|
|
| | 4-(4-Trifluoromethyl-phenyl)-piperidin-4-ol Basic information |
| Product Name: | 4-(4-Trifluoromethyl-phenyl)-piperidin-4-ol | | Synonyms: | 4-hydroxy-4-(α,α,α-trifluoro-p-tolyl)piperidine;4-[4-(TRIFLUOROMETHYL)PHENYL]-4-PIPERIDINOL;4-(Trifluoromethylphenyl)-piperidin-4-ol;4-[4-(Trifluoromethyl)phenyl]-4-piperidinol HCl;4-Piperidinol, 4-[4-(trifluoromethyl)phenyl]-;4-(4-Trifluoromethyl-phenyl)-piperidin-4-ol | | CAS: | 39757-71-6 | | MF: | C12H14F3NO | | MW: | 245.24 | | EINECS: | | | Product Categories: | | | Mol File: | 39757-71-6.mol |  |
| | 4-(4-Trifluoromethyl-phenyl)-piperidin-4-ol Chemical Properties |
| Boiling point | 326.6±42.0 °C(Predicted) | | density | 1.253±0.06 g/cm3(Predicted) | | pka | 13.68±0.20(Predicted) | | form | solid | | InChI | 1S/C12H14F3NO/c13-12(14,15)10-3-1-9(2-4-10)11(17)5-7-16-8-6-11/h1-4,16-17H,5-8H2 | | InChIKey | KZZLCYKEVNALMG-UHFFFAOYSA-N | | SMILES | OC1(CCNCC1)c2ccc(cc2)C(F)(F)F |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 4-(4-Trifluoromethyl-phenyl)-piperidin-4-ol Usage And Synthesis |
| Uses | 4-(4-Trifluoromethyl-phenyl)-piperidin-4-ol (cas# 39757-71-6) is an intermediate in the synthesis of trifluperidol (T793533). |
| | 4-(4-Trifluoromethyl-phenyl)-piperidin-4-ol Preparation Products And Raw materials |
|