(R)-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHANOL manufacturers
|
| | (R)-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHANOL Basic information |
| Product Name: | (R)-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHANOL | | Synonyms: | (R)-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHANOL;(1R)-1-[4-(Trifluoromethyl)phenyl]ethan-1-ol;(1R)-1-[4-(Trifluoromethyl)phenyl]ethanol;(αR)-α-Methyl-4-(trifluoromethyl)benzenemethanol;(R)-alpha-Methyl-4-(trifluoromethyl)benzyl alcohol, 4-[(1R)-1-Hydroxyethyl]benzotrifluoride;R-PTF-PEL;Benzenemethanol, a-methyl-4-(trifluoromethyl)-, (aR)-;Benzenemethanol, α-methyl-4-(trifluoromethyl)-, (αR)- | | CAS: | 76155-79-8 | | MF: | C9H9F3O | | MW: | 190.16 | | EINECS: | | | Product Categories: | | | Mol File: | 76155-79-8.mol | ![(R)-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHANOL Structure](CAS/GIF/76155-79-8.gif) |
| | (R)-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHANOL Chemical Properties |
| Boiling point | 233℃ | | density | 1.234 | | Fp | 98℃ | | storage temp. | Store at room temperature | | pka | 13.98±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | Consistent with structure | | InChI | InChI=1/C9H9F3O/c1-6(13)7-2-4-8(5-3-7)9(10,11)12/h2-6,13H,1H3/t6-/s3 | | InChIKey | YMXIDIAEXNLCFT-ISZMHOAENA-N | | SMILES | C1(C(F)(F)F)C=CC([C@H](O)C)=CC=1 |&1:8,r| |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2906290090 |
| | (R)-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHANOL Usage And Synthesis |
| | (R)-1-[4-(TRIFLUOROMETHYL)PHENYL]ETHANOL Preparation Products And Raw materials |
|