| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Acetyl-3-indolinone Basic information |
| Product Name: | 1-Acetyl-3-indolinone | | Synonyms: | IFLAB-BB F1011-0534;AKOS UB-20202;1-ACETYL-1,2-DIHYDRO-INDOL-3-ONE;1-ACETYL-3-INDOLINONE;N-ACETYLINDOXYL;3H-Indol-3-one, 1-acetyl-1,2-dihydro-;1-Acetyl-1,2-dihydro-3H-indol-3-one;N-Acetyl-3-indolinone | | CAS: | 16800-68-3 | | MF: | C10H9NO2 | | MW: | 175.18 | | EINECS: | | | Product Categories: | | | Mol File: | 16800-68-3.mol |  |
| | 1-Acetyl-3-indolinone Chemical Properties |
| Melting point | 133-134 °C(Solv: ethanol (64-17-5); water (7732-18-5)) | | Boiling point | 411.2±34.0 °C(Predicted) | | density | 1.275±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -1.85±0.20(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C10H9NO2/c1-7(12)11-6-10(13)8-4-2-3-5-9(8)11/h2-5H,6H2,1H3 | | InChIKey | AUMJJQZNOVOCGY-UHFFFAOYSA-N | | SMILES | N1(C(C)=O)C2=C(C=CC=C2)C(=O)C1 |
| Hazard Codes | Xn | | Risk Statements | 22-43 | | Safety Statements | 36/37 | | HazardClass | IRRITANT | | HS Code | 2933790090 |
| | 1-Acetyl-3-indolinone Usage And Synthesis |
| Chemical Properties | Pale yellow crystals | | Uses | 1-Acetyl-3-indolinone is mainly used as an intermediate in organic synthesis and pharmaceuticals, for the synthesis of indole derivatives, dyes and related drug molecules. |
| | 1-Acetyl-3-indolinone Preparation Products And Raw materials |
|