| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dimethyl-d6 sulfide Basic information |
| | Dimethyl-d6 sulfide Chemical Properties |
| Boiling point | 36.5 °C (lit.) | | density | 0.928 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.431(lit.) | | Fp | −34 °F | | solubility | Chloroform (Soluble), Ethyl Acetate (Slightly), Methanol (Sparingly) | | form | Liquid | | color | Colourless | | BRN | 2036892 | | InChI | 1S/C2H6S/c1-3-2/h1-2H3/i1D3,2D3 | | InChIKey | QMMFVYPAHWMCMS-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])SC([2H])([2H])[2H] |
| Hazard Codes | F,Xn | | Risk Statements | 22-36/37/38-41 | | Safety Statements | 16-23-26-36 | | RIDADR | UN 1164 3/PG 2 | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 2 |
| | Dimethyl-d6 sulfide Usage And Synthesis |
| Uses | Isotope labelled 1,1тАЩ-Thiobismethane is used in the synthesis of heterocyclic carbene complexes that are toxic to cancer cells. It is also used in the synthesis of compounds displaying antimalarial activity. | | General Description | Dimethyl sulfide-d6 [(CD3)2S] is a deuterated NMR solvent useful in NMR-based research and analyses. It can form 1:1 complex with halothane by the formation of C–H…S hydrogen bonds. During the reaction of (CD3)2S with singlet oxygen in aprotic solvents, the H-D exchange in the methyl group was observed. The electronic spectra of (CD3)2S has been measured between 1250 and 2500. |
| | Dimethyl-d6 sulfide Preparation Products And Raw materials |
|