| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Dimethyl-d6 sulfone Basic information |
| Product Name: | Dimethyl-d6 sulfone | | Synonyms: | DIMETHYL SULFONE (D6);METHYL-D3 SULFONE, 99 ATOM % D;D7964Dimethyl Sulfone-D6;METHYL-D3 SULFONE;Dimethyl sulfone-d?;Dimethyl sulfone-d6;Dimethyl sulfone (D?, 98%);Dimethyl-d6 sulfone | | CAS: | 22230-82-6 | | MF: | C2D6O2S | | MW: | 100.17 | | EINECS: | | | Product Categories: | | | Mol File: | 22230-82-6.mol |  |
| | Dimethyl-d6 sulfone Chemical Properties |
| Melting point | 107-109 °C(lit.) | | Boiling point | 238 °C(lit.) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly) | | form | Solid | | color | White to Off-White | | InChI | 1S/C2H6O2S/c1-5(2,3)4/h1-2H3/i1D3,2D3 | | InChIKey | HHVIBTZHLRERCL-WFGJKAKNSA-N | | SMILES | [2H]C([2H])([2H])S(=O)(=O)C([2H])([2H])[2H] | | CAS Number Unlabeled | 67-71-0 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | Dimethyl-d6 sulfone Usage And Synthesis |
| Uses | Dimethyl-d6 Sulfone is the labeled analogue of Dimethyl Sulfone (D479350), It can be used as as a high-temperature solvent for both inorganic and organic substances, due to its polarity and thermal stability. It has been also shown to be used for the treatment of Osteoarthritis, in combination with other compounds. |
| | Dimethyl-d6 sulfone Preparation Products And Raw materials |
|