|
|
| | 2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-α-D-arabinofuranose discontinued Basic information |
| Product Name: | 2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-α-D-arabinofuranose discontinued | | Synonyms: | 2-FLUORO-2-DEOXY-1,3,5-TRI-O-ACETYL-A-D-ARABINOFURANOSEDISCONTINUED;2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-alpha-D-arabinofuranose;2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-a-D-arabinofuranose;1,3,5-Tri-O-acetyl-2-deoxy-2-fluoro-a-D-arabinofuranose;acetic acid (3,5-diacetyloxy-4-fluoro-2-oxolanyl)methyl ester;2-Deoxy-2-fluoro-D-arabinofuranose triacetate;2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-a-arabinofuranose;2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-α-D-arabinofuranose
Discontinued | | CAS: | 444586-86-1 | | MF: | C11H15FO7 | | MW: | 278.23 | | EINECS: | 1533716-785-6 | | Product Categories: | Carbohydrates & Derivatives | | Mol File: | 444586-86-1.mol |  |
| | 2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-α-D-arabinofuranose discontinued Chemical Properties |
| Boiling point | 332.8±42.0 °C(Predicted) | | density | 1.29 | | InChI | InChI=1S/C11H15FO7/c1-5(13)16-4-8-10(17-6(2)14)9(12)11(19-8)18-7(3)15/h8-11H,4H2,1-3H3/t8-,9+,10-,11/m1/s1 | | InChIKey | RUHDSMRRCLJPJM-GZBOUJLJSA-N | | SMILES | C1(OC(=O)C)O[C@H](COC(=O)C)[C@@H](OC(=O)C)[C@@H]1F |
| | 2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-α-D-arabinofuranose discontinued Usage And Synthesis |
| Uses | D-Arabinofuranose,2-deoxy-2-fluoro,1,3,5-triacetateis a class of biochemical reagents used in glycobiology research. Glycobiology studies the structure, synthesis, biology, and evolution of sugars. It involves carbohydrate chemistry, enzymology of glycan formation and degradation, protein-glycan recognition, and the role of glycans in biological systems. This field is closely related to basic research, biomedicine, and biotechnology[1]. | | References | [1] Varki A, et al editors. Essentials of Glycobiology [Internet]. 4th ed. Cold Spring Harbor (NY): Cold Spring Harbor Laboratory Press; 2022. PMID:35536922 |
| | 2-Fluoro-2-deoxy-1,3,5-tri-O-acetyl-α-D-arabinofuranose discontinued Preparation Products And Raw materials |
|