| Company Name: |
Shanghai Aladdin Bio-Chem Technology Co.,LTD
|
| Tel: |
400-6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:Sandoz 58-035
CAS:78934-83-5
Purity:>=97% Package:5mg/RMB 929.90;25mg/RMB 3299.90
|
| Company Name: |
Guangzhou Isun Pharmaceutical Co., Ltd
|
| Tel: |
020-39119399 18927568969 |
| Email: |
isunpharm@qq.com |
| Products Intro: |
Product Name:Sandoz 58-035
CAS:78934-83-5
Purity:>=98% (HPLC) Package:5MG; 25MG; 100MG; 1G
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Sandoz 58-035
CAS:78934-83-5
Purity:>98% (HPLC), powder Package:5MG Remarks:S9318-5MG
|
|
| | SANDOZ 58-035 Basic information |
| Product Name: | SANDOZ 58-035 | | Synonyms: | SAN 58035;SA 58-035, 3-[Decyldimethylsilyl]-N-[2-(4-methylphenyl)-1-phenethyl]propanamide;3-(Decyldimethylsilyl)-N-[2-(4-methylphenyl)-1-phenylethyl]propanamide;Compound-58-035;N-[1-Phenyl-2-(4-methylphenyl)ethyl]-3-(decyldimethylsilyl)propanamide;Propanamide, 3-(decyldimethylsilyl)-N-[2-(4-methylphenyl)-1-phenylethyl]-;Sandoz 58-035 >98% (HPLC), powder | | CAS: | 78934-83-5 | | MF: | C30H47NOSi | | MW: | 465.79 | | EINECS: | | | Product Categories: | | | Mol File: | 78934-83-5.mol |  |
| | SANDOZ 58-035 Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: 16 mg/mL | | form | solid | | color | white | | InChI | 1S/C30H47NOSi/c1-5-6-7-8-9-10-11-15-23-33(3,4)24-22-30(32)31-29(28-16-13-12-14-17-28)25-27-20-18-26(2)19-21-27/h12-14,16-21,29H,5-11,15,22-25H2,1-4H3,(H,31,32) | | InChIKey | NBYATBIMYLFITE-UHFFFAOYSA-N | | SMILES | C(NC(C1=CC=CC=C1)CC1=CC=C(C)C=C1)(=O)CC[Si](CCCCCCCCCC)(C)C |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | SANDOZ 58-035 Usage And Synthesis |
| Uses | Sandoz 58-035 was used to induce simultaneous activation of unfolded protein response (UPR) and pattern recognition receptors (PRRs) in mouse peritoneal macrophages.3 | | Biochem/physiol Actions | Sandoz 58-035 inhibits the accumulation of cholesteryl esters and inhibits the esterification of cholesterol by 95% in arterial smooth muscle cells in culture.1 It does not affect the triglyceride metabolism by the gut.2 |
| | SANDOZ 58-035 Preparation Products And Raw materials |
|