- Oxfenicine
-
- $40.00
-
2026-05-11
- CAS:32462-30-9
- Purity: 99.60%
- Supply Ability: 10g
|
| | 4-Hydroxy-L-phenylglycine Basic information |
| Product Name: | 4-Hydroxy-L-phenylglycine | | Synonyms: | H-PHG(4-HYDROXY)-OH;H-HPG-OH;L-(+)-A-4-HYDROXYPHENYLGLYCINE;L-4-HYDROXYPHENYLGLYCINE;L-(+)-P-HYDROXYPHENYLGLYCINE;L-NORTYR;4-HYDROXY-L-PHENYLGLYCINE;(S)-AMINO-(4-HYDROXY-PHENYL)-ACETIC ACID | | CAS: | 32462-30-9 | | MF: | C8H9NO3 | | MW: | 167.16 | | EINECS: | 251-061-7 | | Product Categories: | Amino ACIDS SERIES | | Mol File: | 32462-30-9.mol |  |
| | 4-Hydroxy-L-phenylglycine Chemical Properties |
| Melting point | ~240 °C (dec.) | | alpha | 158 º (c=1% in 1M HCl) | | Boiling point | 365.8±32.0 °C(Predicted) | | density | 1.396±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Aquous Acid (Slightly), DMSO (Slightly, Heated, Sonicated), Water (Slightly) | | pka | 2.15±0.10(Predicted) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D +158±3°, c = 1% in 1 M HCl | | BRN | 3589845 | | Major Application | peptide synthesis | | InChI | InChI=1/C8H9NO3/c9-7(8(11)12)5-1-3-6(10)4-2-5/h1-4,7,10H,9H2,(H,11,12)/t7-/s3 | | InChIKey | LJCWONGJFPCTTL-ZETCQYMHSA-N | | SMILES | [C@@H](C1C=CC(O)=CC=1)(N)C(=O)O |&1:0,r| | | CAS DataBase Reference | 32462-30-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzeneacetic acid, .alpha.-amino-4-hydroxy-, (.alpha.S)- (32462-30-9) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2922.50.4000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-Hydroxy-L-phenylglycine Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | Vasodilator. | | Uses | 4-Hydroxy-L-(+)-2-phenylglycine is a carnitine palmitoyltransferase-1 inhibitor. 4-Hydroxy-L-(+)-2-phenylglycine improves whole-body glucose tolerance and insulin sensitivity in high-fat diet-induced obese mouse with insulin resistance. | | Definition | ChEBI: The L-enantiomer of 4-hydroxyphenylglycine. | | reaction suitability | reaction type: solution phase peptide synthesis | | in vivo | Oxfenicine (150 mg/kg, i.p., once daily for 3 weeks) treatment significantly reduces adiposity in high-fat diet rats[4]. | Animal Model: | Male Sprague-Dawley rats fed a high-fat (HF) diet[4] | | Dosage: | 150 mg/kg | | Administration: | intraperitoneal injection (i.p.) once daily for 3 weeks | | Result: | Reduced whole-body fat oxidation, body weight, adiposity, and improved insulin sensitivity in HF-fed rats. |
|
| | 4-Hydroxy-L-phenylglycine Preparation Products And Raw materials |
|