4-(Maleinimido)phenyl isocyanate* manufacturers
|
| | 4-(Maleinimido)phenyl isocyanate* Basic information |
| Product Name: | 4-(Maleinimido)phenyl isocyanate* | | Synonyms: | PMPI (p-maleimidophenyl isocyanate);1-(4-isocyanatophenyl)-1H-pyrrole-2,5-dione;p-MaleiMidophenyl isocynate;N-(p-MaleiMidophenyl)isocyanate(PMPI);4-(MALEINIMIDO)PHENYL ISOCYANATE 97+%;1H-Pyrrole-2,5-dione,1-(4-isocyanatophenyl)-(9CI);1H-Pyrrole-2,5-dione, 1-(4-isocyanatophenyl)-;Isocyanic Acid 4-Maleimidophenyl Ester | | CAS: | 123457-83-0 | | MF: | C11H6N2O3 | | MW: | 214.18 | | EINECS: | | | Product Categories: | heteroXlink;ISOCYANATE | | Mol File: | 123457-83-0.mol |  |
| | 4-(Maleinimido)phenyl isocyanate* Chemical Properties |
| Melting point | 120-125 °C | | Boiling point | 375.4±25.0 °C(Predicted) | | density | 1.33±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | -1.58±0.20(Predicted) | | form | solid | | InChI | InChI=1S/C11H6N2O3/c14-7-12-8-1-3-9(4-2-8)13-10(15)5-6-11(13)16/h1-6H | | InChIKey | OJQSISYVGFJJBY-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C(N=C=O)C=C2)C(=O)C=CC1=O |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-42 | | Safety Statements | 22-36/37-45 | | WGK Germany | 3 | | F | 10-21 | | HS Code | 29291090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | 4-(Maleinimido)phenyl isocyanate* Usage And Synthesis |
| Uses | 4-Maleimidophenyl isocyanate is a biochemical reagent. | | reaction suitability | reagent type: linker |
| | 4-(Maleinimido)phenyl isocyanate* Preparation Products And Raw materials |
|