N-(4-AMINOPHENYL)MALEIMIDE manufacturers
|
| | N-(4-AMINOPHENYL)MALEIMIDE Basic information |
| | N-(4-AMINOPHENYL)MALEIMIDE Chemical Properties |
| Melting point | 173 °C | | Boiling point | 401.0±28.0 °C(Predicted) | | density | 1.419±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | powder to crystal | | pka | 3.70±0.10(Predicted) | | color | Light yellow to Brown | | InChI | InChI=1S/C10H8N2O2/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h1-6H,11H2 | | InChIKey | XOPCHXSYQHXLHJ-UHFFFAOYSA-N | | SMILES | N1(C2=CC=C(N)C=C2)C(=O)C=CC1=O | | CAS DataBase Reference | 29753-26-2(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2925199590 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | N-(4-AMINOPHENYL)MALEIMIDE Usage And Synthesis |
| | N-(4-AMINOPHENYL)MALEIMIDE Preparation Products And Raw materials |
|