| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
inquiry@bocsci.com |
5-Bromouridine 5'-triphosphate sodium manufacturers
|
| | 5-Bromouridine 5'-triphosphate sodium Basic information |
| | 5-Bromouridine 5'-triphosphate sodium Chemical Properties |
| storage temp. | -20°C | | solubility | water: 50 mg/mL, clear, colorless | | form | Solid | | color | White to off-white | | biological source | synthetic (organic) | | InChI | 1S/3Na/q3*+1 | | InChIKey | BVPYARCRLTXGBD-UHFFFAOYSA-N | | SMILES | OP(OP(OP(O)(O)=O)(O)=O)(OC[C@H]1O[C@@H](N(C=C2Br)C(NC2=O)=O)[C@H](O)[C@@H]1O)=O.[Na] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 5-Bromouridine 5'-triphosphate sodium Usage And Synthesis |
| Uses | 5-Bromouridine 5′-triphosphate (5-BrUTP) is used to measure transcription via labeling of ribonucleic acids (RNA). RNA or cells labeled via 5-BrUTP incorporation may be detected immunologically with antibodies. |
| | 5-Bromouridine 5'-triphosphate sodium Preparation Products And Raw materials |
|