|
|
| | 2-(4-PYRIDYL)BENZIMIDAZOLE Basic information |
| | 2-(4-PYRIDYL)BENZIMIDAZOLE Chemical Properties |
| Melting point | 218 °C | | Boiling point | 438.1±47.0 °C(Predicted) | | density | 1.270±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 10.68±0.10(Predicted) | | color | White to Light red | | InChI | InChI=1S/C12H9N3/c1-2-4-11-10(3-1)14-12(15-11)9-5-7-13-8-6-9/h1-8H,(H,14,15) | | InChIKey | UYWWLYCGNNCLKE-UHFFFAOYSA-N | | SMILES | C1(C2C=CN=CC=2)NC2=CC=CC=C2N=1 |
| | 2-(4-PYRIDYL)BENZIMIDAZOLE Usage And Synthesis |
| | 2-(4-PYRIDYL)BENZIMIDAZOLE Preparation Products And Raw materials |
|