|
|
| | 4-Pentylbicyclo(2.2.2)octane-1-carboxyl& Basic information |
| | 4-Pentylbicyclo(2.2.2)octane-1-carboxyl& Chemical Properties |
| Melting point | 160-162 °C(lit.) | | storage temp. | room temp | | form | powder or crystals | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C14H24O2/c1-2-3-4-5-13-6-9-14(10-7-13,11-8-13)12(15)16/h2-11H2,1H3,(H,15,16)/t13-,14- | | InChIKey | IAQHPZFALQQESM-HDJSIYSDSA-N | | SMILES | CCCCC[C@@]12CC[C@@](CC1)(CC2)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 4-Pentylbicyclo(2.2.2)octane-1-carboxyl& Usage And Synthesis |
| Uses | diagnostic assay manufacturing hematology histology |
| | 4-Pentylbicyclo(2.2.2)octane-1-carboxyl& Preparation Products And Raw materials |
|