| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | PSB 1115 POTASSIUM SALT Basic information |
| Product Name: | PSB 1115 POTASSIUM SALT | | Synonyms: | 1-Propyl-8-(4-sulfophenyl)xanthine hydrate potassium salt;PSB 1115 hydrate potassium salt;1-Propyl-8-(4-sulfophenyl)xanthine potassium salt hydrate;PSB 1115 potassium salt hydrate;PSB-1115 (potassium);PSB 1115 | | CAS: | 409344-71-4 | | MF: | C14H15KN4O5S | | MW: | 390.46 | | EINECS: | | | Product Categories: | | | Mol File: | 409344-71-4.mol |  |
| | PSB 1115 POTASSIUM SALT Chemical Properties |
| storage temp. | 2-8°C | | solubility | DMSO: ~4 mg/mL | | form | solid | | color | off-white | | InChI | 1S/C14H14N4O5S.K/c1-2-7-18-13(19)10-12(17-14(18)20)16-11(15-10)8-3-5-9(6-4-8)24(21,22)23;/h3-6H,2,7H2,1H3,(H,15,16)(H,17,20)(H,21,22,23);/q;+1/p-1 | | InChIKey | CJOWSBOERSTJAR-UHFFFAOYSA-M | | SMILES | CCCN1C(=O)Nc2nc([nH]c2C1=O)-c3ccc(cc3)S(=O)(=O)O[K] |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | PSB 1115 POTASSIUM SALT Usage And Synthesis |
| Uses | PSB 1115 is an Adenosine A2B-R antagonist. | | Biological Activity | Highly selective, water-soluble, human A 2B adenosine receptor antagonist. K i values are 53.4, > 10000 and > 10000 nM at human A 2B , A 1 and A 3 receptors respectively. Also selective versus rat A 1 and A 2A receptors (K i values are 2200 and 24000 nM respectively). Produces potent analgesic effects in vivo . | | Biochem/physiol Actions | PSB 1115 is a highly selective, water-soluble, human A2B adenosine receptor antagonist. |
| | PSB 1115 POTASSIUM SALT Preparation Products And Raw materials |
|