| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (4-Phenoxyphenyl)diphenylsulfonium Basic information |
| | (4-Phenoxyphenyl)diphenylsulfonium Chemical Properties |
| Melting point | 90-94 °C(lit.) | | λmax | 256 nm | | InChI | 1S/C24H19OS.CHF3O3S/c1-4-10-20(11-5-1)25-21-16-18-24(19-17-21)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23;2-1(3,4)8(5,6)7/h1-19H;(H,5,6,7)/q+1;/p-1 | | InChIKey | DFSWKIGXUOJVAC-UHFFFAOYSA-M | | SMILES | [O-]S(=O)(=O)C(F)(F)F.O(c1ccccc1)c2ccc(cc2)[S+](c3ccccc3)c4ccccc4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (4-Phenoxyphenyl)diphenylsulfonium Usage And Synthesis |
| Uses | Cationic photoinitiator. Photoacid generator. |
| | (4-Phenoxyphenyl)diphenylsulfonium Preparation Products And Raw materials |
|