|
|
| | 1,4-Naphthalenedione, 2,3-diamino- Basic information | | Uses |
| Product Name: | 1,4-Naphthalenedione, 2,3-diamino- | | Synonyms: | 1,4-Naphthalenedione, 2,3-diamino-;2,3-Diaminonaphthalene-1,4-dione;2,3-diamino-1,4-naphthalenedione;2,3-diamino-1,4-naphthoquinone;DANQ | | CAS: | 13755-95-8 | | MF: | C10H8N2O2 | | MW: | 188.18 | | EINECS: | | | Product Categories: | | | Mol File: | 13755-95-8.mol |  |
| | 1,4-Naphthalenedione, 2,3-diamino- Chemical Properties |
| Melting point | 230 °C | | Boiling point | 324.5±42.0 °C(Predicted) | | density | 1.407±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 2.00±0.20(Predicted) | | Appearance | Dark purple to black Solid | | InChI | InChI=1S/C10H8N2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H,11-12H2 | | InChIKey | YGFBBXYYCLHOOW-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C(N)=C1N |
| | 1,4-Naphthalenedione, 2,3-diamino- Usage And Synthesis |
| Uses | 2,3-Diaminonaphthalene-1,4-dione is mainly used in organic synthesis and scientific research experiments. |
| | 1,4-Naphthalenedione, 2,3-diamino- Preparation Products And Raw materials |
|