| Company Name: |
ChemShuttle, Inc. |
| Tel: |
0510-83588313-811 18800520310 |
| Email: |
sales@chemshuttle.com |
| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Methotrexate α-tert-Butyl Ester Basic information |
| Product Name: | Methotrexate α-tert-Butyl Ester | | Synonyms: | Methotrexate α-tert-Butyl Ester;(S)-5-(tert-butoxy)-4-(4-(((2,4-diaminopteridin-6-yl)methyl)(methyl)amino)benzamido)-5-oxopentanoic acid;L-Glutamic acid, N-[4-[[(2,4-diamino-6-pteridinyl)methyl]methylamino]benzoyl]-, 1-(1,1-dimethylethyl) ester;Methotrexate a-tert-Butyl Ester;Methotrexate Impurity 8 | | CAS: | 79640-70-3 | | MF: | C24H30N8O5 | | MW: | 510.55 | | EINECS: | | | Product Categories: | | | Mol File: | 79640-70-3.mol |  |
| | Methotrexate α-tert-Butyl Ester Chemical Properties |
| Melting point | >211°C (dec.) | | density | 1.377±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | Aqueous Base (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 4.43±0.10(Predicted) | | color | Pale Yellow to Orange | | InChIKey | HTMMDBDGHQUHPW-INIZCTEOSA-N | | SMILES | NC1=NC(=NC2N=CC(=NC=21)CN(C1C=CC(=CC=1)C(=O)N[C@@H](CCC(=O)O)C(=O)OC(C)(C)C)C)N |
| | Methotrexate α-tert-Butyl Ester Usage And Synthesis |
| Uses | Methotrexate α-tert-Butyl Ester is an intermediate to the synthesis of folic acid antagonist Methotrexate (M260675) used in the study of membrane-associated folate transporters from L1210 cells. | | in vivo | Lys-MTXcleavable- (OtBu) significantly reduces tumor growth in HT1080 tumor bearing mice[1].
The protection of the α-carboxyl group of methotrexate may be used to improve the circulatory half-life and reduce the liver accumulation of similar MTX-conjugated dendrimers, while still retaining antitumor activity in vivo[1]. | Animal Model: | Female, Balb/c nu/nu, 6 weeks (bearing HT1080 cells)[1] | | Dosage: | 30 mg/kg | | Administration: | Once per week for 2 weeks | | Result: | Showed a significant (63%) reduction in tumor size on day 12.
|
|
| | Methotrexate α-tert-Butyl Ester Preparation Products And Raw materials |
|