|
|
| | 5-ACETYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE Basic information |
| Product Name: | 5-ACETYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE | | Synonyms: | 1,3-Dioxane-4,6-dione, 5-acetyl-2,2-diMethyl-;5-ACETYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE;5-Acetyl-2,2-dimethyl-1,3- dioxane-4,6-dione (Acetyl
Meldrum's Acid);Acetyl-meldrum's acid | | CAS: | 72324-39-1 | | MF: | C8H10O5 | | MW: | 186.16 | | EINECS: | | | Product Categories: | | | Mol File: | 72324-39-1.mol |  |
| | 5-ACETYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE Chemical Properties |
| Melting point | 83-85°C | | Boiling point | 417.9±45.0 °C(Predicted) | | density | 1.231 | | storage temp. | Store at room temperature | | pka | 8.09±0.40(Predicted) | | Appearance | Light yellow to brown Solid | | InChI | InChI=1S/C8H10O5/c1-4(9)5-6(10)12-8(2,3)13-7(5)11/h5H,1-3H3 | | InChIKey | BTJDMDJIAAHSRG-UHFFFAOYSA-N | | SMILES | O1C(=O)C(C(C)=O)C(=O)OC1(C)C |
| Risk Statements | 10 | | Safety Statements | 16 | | RIDADR | 1224 | | HazardClass | IRRITANT |
| | 5-ACETYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE Usage And Synthesis |
| | 5-ACETYL-2,2-DIMETHYL-1,3-DIOXANE-4,6-DIONE Preparation Products And Raw materials |
|