| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 2,7-Dinitronaphthalene Basic information |
| | 2,7-Dinitronaphthalene Chemical Properties |
| Melting point | 229-233 °C | | Boiling point | 413.5±18.0 °C(Predicted) | | density | 1.481±0.06 g/cm3(Predicted) | | BRN | 2214687 | | InChI | 1S/C10H6N2O4/c13-11(14)9-3-1-7-2-4-10(12(15)16)6-8(7)5-9/h1-6H | | InChIKey | AFDWAIQLYHEUIW-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1ccc2ccc(cc2c1)[N+]([O-])=O |
| Risk Statements | 52/53 | | Safety Statements | 61 | | RIDADR | 2811 | | WGK Germany | 3 | | RTECS | QJ4552500 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 13 - Non Combustible Solids |
| | 2,7-Dinitronaphthalene Usage And Synthesis |
| Uses | 2,7-Dinitronaphthalene has been used for the cyclodextrin distribution capillary electrochromatographic separation of naphthalene compounds. | | Definition | ChEBI: 2,7-dinitronaphthalene is a dinitronaphthalene. | | General Description | Kinetics and ESR studies of intramolecular electron-transfer reactions of the radical anion of 2,7-dinitronaphthalene in various polar aprotic solvents has been studied. 2,7-Dinitronaphthalene undergoes mononitration to afford 1:3:6:8-tetranitronapthalene. |
| | 2,7-Dinitronaphthalene Preparation Products And Raw materials |
|