|
|
| | 4-Amino-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-methyl ester Basic information |
| Product Name: | 4-Amino-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-methyl ester | | Synonyms: | 4-amino-1,4-Piperidinedicarboxylic acid 1-(1,1-dimethylethyl) 4-methyl ester;4,4-ACP(1-N-BOC)-OME;1-BOC-4-AMINO-PIPERIDINE-4-CARBOXYLIC ACID METHYL ESTER;1-TERT-BUTYL 4-METHYL 4-AMINOPIPERIDINE-1,4-DICARBOXYLATE;Methyl 1-boc-4-aMinopiperidine-4-carboxylate;1,4-Piperidinedicarboxylic acid, 4-aMino-, 1-(1,1-diMethylethyl) 4-Methyl ester;1-benzyl 4-methyl 4-aminopiperidine-1,4-dicarboxylate;Methyl 1-Boc-4-amino-4-piperidinecarboxylate | | CAS: | 321997-89-1 | | MF: | C12H22N2O4 | | MW: | 258.31 | | EINECS: | | | Product Categories: | | | Mol File: | 321997-89-1.mol |  |
| | 4-Amino-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-methyl ester Chemical Properties |
| Boiling point | 333.6±42.0 °C(Predicted) | | density | 1.131±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 6.68±0.20(Predicted) | | Appearance | Colorless to light yellow Viscous liquid | | InChI | 1S/C12H22N2O4/c1-11(2,3)18-10(16)14-7-5-12(13,6-8-14)9(15)17-4/h5-8,13H2,1-4H3 | | InChIKey | MMPCQLBEECGPAP-UHFFFAOYSA-N | | SMILES | COC(=O)C1(N)CCN(CC1)C(=O)OC(C)(C)C |
| | 4-Amino-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-methyl ester Usage And Synthesis |
| | 4-Amino-piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-methyl ester Preparation Products And Raw materials |
|