|
|
| | 4-Amino-1-Boc-piperidine-4-carboxylic acid Basic information |
| | 4-Amino-1-Boc-piperidine-4-carboxylic acid Chemical Properties |
| Melting point | 290°C | | Boiling point | 387.21°C (rough estimate) | | density | 1.1583 (rough estimate) | | refractive index | 1.4620 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Methanol | | form | Solid | | pka | 2.15±0.20(Predicted) | | color | White to Off-White | | BRN | 7588844 | | InChI | InChI=1S/C11H20N2O4/c1-10(2,3)17-9(16)13-6-4-11(12,5-7-13)8(14)15/h4-7,12H2,1-3H3,(H,14,15) | | InChIKey | YNHLVALLAURVJF-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(N)(C(O)=O)CC1 | | CAS DataBase Reference | 183673-71-4(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-24/25 | | WGK Germany | 3 | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids |
| | 4-Amino-1-Boc-piperidine-4-carboxylic acid Usage And Synthesis |
| Chemical Properties | White Powder | | Uses | An a,a-Disubstituted Amino Acid for preparation of water-soluble highly helical peptides | | Uses | An α,α-Disubstituted amino acid for preparation of water-soluble highly helical peptides. | | Uses | Cyclic α,α-disubstituted amino acid for the preparation of water-soluble highly helical peptides. |
| | 4-Amino-1-Boc-piperidine-4-carboxylic acid Preparation Products And Raw materials |
|