| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-Methylnaphthalene-d10 Basic information |
| Product Name: | 1-Methylnaphthalene-d10 | | Synonyms: | 1-METHYLNAPHTHALENE-D10, 98 ATOM % D;ALPHA-Methylnaphthalene-d10;1-Methylnaphthalene-d??;1-Methylnaphthalene-d10 in isooctane;1-Methylnaphthalene-d10;1-Methylnaphthalene (D??, 98%);1-Methylnaphthalene (D??, 98%) 200 μg/mL in isooctane;1-Methylnaphthalene-d10 | | CAS: | 38072-94-5 | | MF: | C11H10 | | MW: | 142.2 | | EINECS: | | | Product Categories: | Alphabetical Listings;Stable Isotopes;M | | Mol File: | 38072-94-5.mol |  |
| | 1-Methylnaphthalene-d10 Chemical Properties |
| Boiling point | 240-243 °C (lit.) | | density | 1.070 g/mL at 25 °C | | refractive index | n20/D 1.614(lit.) | | Fp | 180 °F | | form | liquid | | Henry's Law Constant | 4.6×10-2 mol/(m3Pa) at 25℃, Hiatt (2013) | | InChI | 1S/C11H10/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-8H,1H3/i1D3,2D,3D,4D,5D,6D,7D,8D | | InChIKey | QPUYECUOLPXSFR-UZHHFJDZSA-N | | SMILES | [2H]c1c([2H])c([2H])c2c(c([2H])c([2H])c([2H])c2c1[2H])C([2H])([2H])[2H] |
| Hazard Codes | Xn,N | | Risk Statements | 22-36/37/38-42/43-51/53 | | Safety Statements | 7-26-36/37/39-61-45-36/37-23 | | RIDADR | UN3082 - class 9 - PG 3 - DOT NA1993 - Environmentally hazardous substances, liquid, n.o.s. HI: all (not BR) | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
Asp. Tox. 1 |
| | 1-Methylnaphthalene-d10 Usage And Synthesis |
| Uses | 1-Methylnaphthalene-d10 (CAS# 38072-94-5) is a useful isotopically labeled research compound. |
| | 1-Methylnaphthalene-d10 Preparation Products And Raw materials |
|