|
|
| | 2-Methylnaphthalene-d10 Basic information |
| Product Name: | 2-Methylnaphthalene-d10 | | Synonyms: | 2-METHYLNAPHTHALENE-D10, 98 ATOM % D;2-METHYLNATHTHALENE-D10;1,2,3,4,5,6,8-heptadeuterio-7-(trideuteriomethyl)naphthalene;[2H10]-2-Methylnaphthalene;2-Methylnaphthalene(d10)Solution in Isooctane;2-Methylnaphthalene-d10 in isooctane;2-Methylnaphthalene-d10;2-Methylnaphthalene (D??, 98%) 200 μg/mL in isooctane | | CAS: | 7297-45-2 | | MF: | C11D10 | | MW: | 152.26 | | EINECS: | | | Product Categories: | Alphabetical Listings;M;Stable Isotopes | | Mol File: | 7297-45-2.mol |  |
| | 2-Methylnaphthalene-d10 Chemical Properties |
| Melting point | 34-36 °C(lit.) | | Boiling point | 241-242 °C(lit.) | | density | 1.071 g/mL at 25 °C(lit.) | | Fp | 208 °F | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Low-Melting Solid | | color | White to Off-White | | InChI | 1S/C11H10/c1-9-6-7-10-4-2-3-5-11(10)8-9/h2-8H,1H3/i1D3,2D,3D,4D,5D,6D,7D,8D | | InChIKey | QIMMUPPBPVKWKM-UZHHFJDZSA-N | | SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(c([2H])c([2H])c2c1[2H])C([2H])([2H])[2H] | | EPA Substance Registry System | Naphthalene-1,2,3,4,5,6,8-d7, 7-(methyl-d3)- (7297-45-2) |
| Hazard Codes | Xn,N | | Risk Statements | 22-36/37/38-51/53 | | Safety Statements | 26-37/39-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Methylnaphthalene-d10 Usage And Synthesis |
| | 2-Methylnaphthalene-d10 Preparation Products And Raw materials |
|