| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
4-((N-Boc-amino)methyl)phenylboronic acid manufacturers
|
| | 4-((N-Boc-amino)methyl)phenylboronic acid Basic information | | Preparation Uses |
| | 4-((N-Boc-amino)methyl)phenylboronic acid Chemical Properties |
| Melting point | 208-210°C | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,2-8°C | | pka | 8.54±0.16(Predicted) | | form | solid | | color | white | | InChI | 1S/C12H18BNO4/c1-12(2,3)18-11(15)14-8-9-4-6-10(7-5-9)13(16)17/h4-7,16-17H,8H2,1-3H3,(H,14,15) | | InChIKey | MUBGEKQUCSEECZ-UHFFFAOYSA-N | | SMILES | B(O)(O)c1ccc(cc1)CNC(=O)OC(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Hazard Note | Irritant/Keep Cold | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids |
| | 4-((N-Boc-amino)methyl)phenylboronic acid Usage And Synthesis |
| Preparation | Di-tert-butyl dicarbonate (3.5 g, 16 mmol) and triethylamine (13 mL, 9.4 mmol) were added to a stirred solution of 4-aminomethylphenylboronic acid (3 g, 16 mmol) in tetrahydrofuran (100 mL). The reaction was stirred under reflux for 1 hour, then the solvent was evaporated and the residue was partitioned between water and ethyl acetate. The organic phase was concentrated under reduced pressure to give 4-(N-BOC-aminomethyl)phenylboronic acid (2.67 g, 10.6 mmol) as a white solid. | | Uses | 4-(N-Boc-aminomethyl)phenylboronic acid, can be used in the preparation of lipid pore-filled silica thin-film membranes for biomimetic recovery of diluted carbohydrates. | | Uses | 4-(Boc-aminomethyl)benzeneboronic acid is a boc protected phenyl boronic acid used for proteomics research. |
| | 4-((N-Boc-amino)methyl)phenylboronic acid Preparation Products And Raw materials |
|