| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3-((N-Boc-amino)methyl)phenylboronic acid Basic information |
| | 3-((N-Boc-amino)methyl)phenylboronic acid Chemical Properties |
| Melting point | 188-190°C | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 8.41±0.10(Predicted) | | InChI | 1S/C12H18BNO4/c1-12(2,3)18-11(15)14-8-9-5-4-6-10(7-9)13(16)17/h4-7,16-17H,8H2,1-3H3,(H,14,15) | | InChIKey | YHAQUGOSDQZIMA-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)NCc1cccc(c1)B(O)O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37/39-36/37 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | HS Code | 2931900090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Skin Sens. 1 |
| | 3-((N-Boc-amino)methyl)phenylboronic acid Usage And Synthesis |
| | 3-((N-Boc-amino)methyl)phenylboronic acid Preparation Products And Raw materials |
|