| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:Benzo[e]pyrene-d12
CAS:205440-82-0
Remarks:CS-C-01098
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:Benzo[e]pyrene-D12
CAS:205440-82-0
Purity:98% 1Mg 5Mg 10Mg
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Benzo[e]pyrene-d12
CAS:205440-82-0
Purity:98 atom % D, 98% (CP) Package:10MG Remarks:616664-10MG
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Benzo[e]pyrene-D12
CAS:205440-82-0
Purity:99% Package:10mg;100mg;1g
|
|
| | BENZO[E]PYRENE-D12 Basic information |
| Product Name: | BENZO[E]PYRENE-D12 | | Synonyms: | BENZO[E]PYRENE-D12;4,5-BENZOPYRENE-D12;Benzo[e]pyrene-d12 98 atom % D, 98% (CP);Benzo[e]pyrene-d??;Benzo[e]pyrene-d12 in toluene;Benzo(e)pyrene(d12)Solution in Isooctane;Nicotinamide Impurity 21;Benzo[e]pyrene-d12 | | CAS: | 205440-82-0 | | MF: | C20D12 | | MW: | 264.38 | | EINECS: | | | Product Categories: | | | Mol File: | 205440-82-0.mol | ![BENZO[E]PYRENE-D12 Structure](CAS/GIF/205440-82-0.gif) |
| | BENZO[E]PYRENE-D12 Chemical Properties |
| Melting point | 177-180 °C(lit.) | | solubility | Acetone (Slightly) | | form | Solid | | color | Yellow | | InChI | 1S/C20H12/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D | | InChIKey | TXVHTIQJNYSSKO-AQZSQYOVSA-N | | SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c3c([2H])c([2H])c([2H])c4c([2H])c([2H])c5c([2H])c([2H])c([2H])c2c5c34 |
| Hazard Codes | T,N | | Risk Statements | 45-50/53 | | Safety Statements | 53-45-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Carc. 1B |
| | BENZO[E]PYRENE-D12 Usage And Synthesis |
| Uses | Benzo[e]pyrene-d12 (CAS# 205440-82-0) is a useful isotopically labeled research compound. |
| | BENZO[E]PYRENE-D12 Preparation Products And Raw materials |
|