|
|
| | L-Glutamic acid (5-13C) Basic information |
| | L-Glutamic acid (5-13C) Chemical Properties |
| Melting point | 205 °C (dec.)(lit.) | | form | solid | | Optical Rotation | [α]25/D +31.0°, c =2 in 5 M HCl | | InChI | 1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i4+1 | | InChIKey | WHUUTDBJXJRKMK-MYXYCAHRSA-N | | SMILES | N[C@@H](CC[13C](O)=O)C(O)=O | | CAS Number Unlabeled | 56-86-0 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Glutamic acid (5-13C) Usage And Synthesis |
| Uses | L-Glutamic acid-5-13C is the 13C-labeled L-Glutamic acid. L-Glutamic acid acts as an excitatory transmitter and an agonist at all subtypes of glutamate receptors (metabotropic, kainate, NMDA, and AMPA). L-Glutamic acid shows a direct activating effect on the release of DA from dopaminergic terminals. | | IC 50 | NMDA Receptor | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Glutamic acid (5-13C) Preparation Products And Raw materials |
|