| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | L-Glutamic acid-13C5 Basic information |
| Product Name: | L-Glutamic acid-13C5 | | Synonyms: | L-GLUTAMIC ACID-13C5, 15N, 99 ATOM % 13C;L-Glutamicacid-13c5,15n99atom%13c99atom%15n;L-Glutamic acid-5-13C,15N;(2S)-2-amino(1,2,3,4,5-13C5)pentanedioic acid;L-Glutamic acid-13C5;L-Glutamic acid (13C?, 99%);L-Glutamic acid-13C5 | | CAS: | 55443-55-5 | | MF: | C5H9NO4 | | MW: | 147.12926 | | EINECS: | | | Product Categories: | | | Mol File: | 55443-55-5.mol |  |
| | L-Glutamic acid-13C5 Chemical Properties |
| Melting point | 205 °C (dec.)(lit.) | | storage temp. | Refrigerator | | solubility | Aqueous Acid (Slightly), Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]25/D +31.0°, c = 2 in 5 M HCl | | InChI | 1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1/i1+1,2+1,3+1,4+1,5+1 | | InChIKey | WHUUTDBJXJRKMK-WIAREEORSA-N | | SMILES | N[13C@@H]([13CH2][13CH2][13C](O)=O)[13C](O)=O | | CAS Number Unlabeled | 56-86-0 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Glutamic acid-13C5 Usage And Synthesis |
| Uses | L-Glutamic Acid-13C5,, is an isotope labelled derivative of L-Glutamic Acid (G596960), a non-essential amino acid. Its salt form (glutamate) is an important neurotransmitter that plays a key role in long-term potentiation and is important for learning and memory. It is also a key molecule in cellular metabolism. | | Definition | ChEBI: L-glutamic acid is an optically active form of glutamic acid having L-configuration. It has a role as a nutraceutical, a micronutrient, an Escherichia coli metabolite, a mouse metabolite, a ferroptosis inducer and a neurotransmitter. It is a glutamine family amino acid, a proteinogenic amino acid, a glutamic acid and a L-alpha-amino acid. It is a conjugate acid of a L-glutamate(1-). It is an enantiomer of a D-glutamic acid. | | General Description | Glutamic acid is an amino acid with an acidic side group. It works as a proton donor. Decarboxylation of glutamic acid results in the formation of GABA (γ aminobutyric acid), a potent neurotransmitter. Isotope labeled amino acids are required for the production of isotopically labeled proteins. | | IC 50 | NMDA Receptor |
| | L-Glutamic acid-13C5 Preparation Products And Raw materials |
|