| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | 1,4-Diphenoxybenzene Basic information |
| | 1,4-Diphenoxybenzene Chemical Properties |
| Melting point | 73-77 °C | | Boiling point | 172°C 0,01mm | | density | 1,083 g/cm3 | | refractive index | 1.5200 (estimate) | | Fp | 202°C | | form | powder to crystal | | color | White to Light yellow | | BRN | 2215945 | | InChI | InChI=1S/C18H14O2/c1-3-7-15(8-4-1)19-17-11-13-18(14-12-17)20-16-9-5-2-6-10-16/h1-14H | | InChIKey | UVGPELGZPWDPFP-UHFFFAOYSA-N | | SMILES | C1(OC2=CC=CC=C2)=CC=C(OC2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 3061-36-7(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1,4-diphenoxy-(3061-36-7) | | EPA Substance Registry System | Benzene, 1,4-diphenoxy- (3061-36-7) |
| Safety Statements | 24/25 | | TSCA | TSCA listed | | HS Code | 29029090 |
| | 1,4-Diphenoxybenzene Usage And Synthesis |
| Chemical Properties | off-white to light brown flakes or pellets | | Definition | ChEBI: 1,4-diphenoxybenzene is adiphenoxybenzene. It is functionally related to a4-phenoxyphenol. |
| | 1,4-Diphenoxybenzene Preparation Products And Raw materials |
|