|
|
| | 4-Fluoro-2-(trifluoromethyl)phenylacetonitrile Basic information |
| | 4-Fluoro-2-(trifluoromethyl)phenylacetonitrile Chemical Properties |
| Boiling point | 222-223 °C (lit.) | | density | 1.364 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.451(lit.) | | Fp | 226 °F | | storage temp. | 2-8°C | | InChI | 1S/C9H5F4N/c10-7-2-1-6(3-4-14)8(5-7)9(11,12)13/h1-2,5H,3H2 | | InChIKey | YTIAVOXEDRIPNR-UHFFFAOYSA-N | | SMILES | Fc1ccc(CC#N)c(c1)C(F)(F)F | | CAS DataBase Reference | 80141-94-2(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 3276 | | WGK Germany | 3 | | HazardClass | TOXIC | | HS Code | 2926907090 | | Storage Class | 10 - Combustible liquids |
| | 4-Fluoro-2-(trifluoromethyl)phenylacetonitrile Usage And Synthesis |
| | 4-Fluoro-2-(trifluoromethyl)phenylacetonitrile Preparation Products And Raw materials |
|